C19H31N3O2 — CID 125189678
2-[(4aR,7S,7aS)-7-(pyridin-2-ylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-N,N-diethylethanamine (PubChem CID 125189678) has the molecular formula C19H31N3O2 and a molecular weight of 333.48 g/mol. Its IUPAC name is 2-[(4aR,7S,7aS)-7-(pyridin-2-ylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-N,N-diethylethanamine.
| Compound Name | 2-[(4aR,7S,7aS)-7-(pyridin-2-ylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-N,N-diethylethanamine |
|---|---|
| PubChem CID | 125189678 |
| Molecular Formula | C19H31N3O2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.24 |
| IUPAC Name | 2-[(4aR,7S,7aS)-7-(pyridin-2-ylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-N,N-diethylethanamine |
| SMILES | CCN(CC)CCN1CCO[C@@H]2[C@@H](OCc3ccccn3)CC[C@H]21 |
| InChI | InChI=1S/C19H31N3O2/c1-3-21(4-2)11-12-22-13-14-23-19-17(22)8-9-18(19)24-15-16-7-5-6-10-20-16/h5-7,10,17-19H,3-4,8-9,11-15H2,1-2H3/t17-,18+,19+/m1/s1 |
| InChIKey | DTJHKXOUJWRMKT-QYZOEREBSA-N |
| XLogP | 2.17 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |