C9H16N2OS — CID 12519162
3-(2-methoxyethyl)-4-propan-2-yl-1H-imidazole-2-thione (PubChem CID 12519162) has the molecular formula C9H16N2OS and a molecular weight of 200.31 g/mol. Its IUPAC name is 3-(2-methoxyethyl)-4-propan-2-yl-1H-imidazole-2-thione.
| Compound Name | 3-(2-methoxyethyl)-4-propan-2-yl-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 12519162 |
| Molecular Formula | C9H16N2OS |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 3-(2-methoxyethyl)-4-propan-2-yl-1H-imidazole-2-thione |
| SMILES | COCCn1c(C(C)C)c[nH]c1=S |
| InChI | InChI=1S/C9H16N2OS/c1-7(2)8-6-10-9(13)11(8)4-5-12-3/h6-7H,4-5H2,1-3H3,(H,10,13) |
| InChIKey | GQMHKLRJLLESMR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|