C10H15F3N2OS — CID 64863377
4-propan-2-yl-3-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-imidazole-2-thione (PubChem CID 64863377) has the molecular formula C10H15F3N2OS and a molecular weight of 268.30 g/mol. Its IUPAC name is 4-propan-2-yl-3-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-imidazole-2-thione.
| Compound Name | 4-propan-2-yl-3-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 64863377 |
| Molecular Formula | C10H15F3N2OS |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 4-propan-2-yl-3-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-imidazole-2-thione |
| SMILES | CC(C)c1c[nH]c(=S)n1CCOCC(F)(F)F |
| InChI | InChI=1S/C10H15F3N2OS/c1-7(2)8-5-14-9(17)15(8)3-4-16-6-10(11,12)13/h5,7H,3-4,6H2,1-2H3,(H,14,17) |
| InChIKey | FSGBFUQNYVEACL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|