C8H11F3N2OS — CID 81335926
4-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-imidazole-2-thione (PubChem CID 81335926) has the molecular formula C8H11F3N2OS and a molecular weight of 240.25 g/mol. Its IUPAC name is 4-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-imidazole-2-thione.
| Compound Name | 4-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 81335926 |
| Molecular Formula | C8H11F3N2OS |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 4-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-imidazole-2-thione |
| SMILES | Cc1c[nH]c(=S)n1CCOCC(F)(F)F |
| InChI | InChI=1S/C8H11F3N2OS/c1-6-4-12-7(15)13(6)2-3-14-5-8(9,10)11/h4H,2-3,5H2,1H3,(H,12,15) |
| InChIKey | BOXGHFNYFMJVNE-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|