C8H11F3N2O2S — CID 66147819
4-(hydroxymethyl)-3-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-imidazole-2-thione (PubChem CID 66147819) has the molecular formula C8H11F3N2O2S and a molecular weight of 256.25 g/mol. Its IUPAC name is 4-(hydroxymethyl)-3-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-imidazole-2-thione.
| Compound Name | 4-(hydroxymethyl)-3-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 66147819 |
| Molecular Formula | C8H11F3N2O2S |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 4-(hydroxymethyl)-3-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-imidazole-2-thione |
| SMILES | OCc1c[nH]c(=S)n1CCOCC(F)(F)F |
| InChI | InChI=1S/C8H11F3N2O2S/c9-8(10,11)5-15-2-1-13-6(4-14)3-12-7(13)16/h3,14H,1-2,4-5H2,(H,12,16) |
| InChIKey | BLZACYFUYHZGEY-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 50.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|