C8H11F3N2OS — CID 115522961
4-(hydroxymethyl)-3-(4,4,4-trifluorobutyl)-1H-imidazole-2-thione (PubChem CID 115522961) has the molecular formula C8H11F3N2OS and a molecular weight of 240.25 g/mol. Its IUPAC name is 4-(hydroxymethyl)-3-(4,4,4-trifluorobutyl)-1H-imidazole-2-thione.
| Compound Name | 4-(hydroxymethyl)-3-(4,4,4-trifluorobutyl)-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 115522961 |
| Molecular Formula | C8H11F3N2OS |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 4-(hydroxymethyl)-3-(4,4,4-trifluorobutyl)-1H-imidazole-2-thione |
| SMILES | OCc1c[nH]c(=S)n1CCCC(F)(F)F |
| InChI | InChI=1S/C8H11F3N2OS/c9-8(10,11)2-1-3-13-6(5-14)4-12-7(13)15/h4,14H,1-3,5H2,(H,12,15) |
| InChIKey | JIDJAJYLHQIPDN-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 40.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|