C7H9F3N2OS — CID 66146571
4-(hydroxymethyl)-3-(3,3,3-trifluoropropyl)-1H-imidazole-2-thione (PubChem CID 66146571) has the molecular formula C7H9F3N2OS and a molecular weight of 226.22 g/mol. Its IUPAC name is 4-(hydroxymethyl)-3-(3,3,3-trifluoropropyl)-1H-imidazole-2-thione.
| Compound Name | 4-(hydroxymethyl)-3-(3,3,3-trifluoropropyl)-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 66146571 |
| Molecular Formula | C7H9F3N2OS |
| Molecular Weight | 226.22 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | 4-(hydroxymethyl)-3-(3,3,3-trifluoropropyl)-1H-imidazole-2-thione |
| SMILES | OCc1c[nH]c(=S)n1CCC(F)(F)F |
| InChI | InChI=1S/C7H9F3N2OS/c8-7(9,10)1-2-12-5(4-13)3-11-6(12)14/h3,13H,1-2,4H2,(H,11,14) |
| InChIKey | YGEGJBFGAJWUCS-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 40.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.22 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|