C7H8F4N2OS — CID 106290827
4-(hydroxymethyl)-3-(2,2,3,3-tetrafluoropropyl)-1H-imidazole-2-thione (PubChem CID 106290827) has the molecular formula C7H8F4N2OS and a molecular weight of 244.21 g/mol. Its IUPAC name is 4-(hydroxymethyl)-3-(2,2,3,3-tetrafluoropropyl)-1H-imidazole-2-thione.
| Compound Name | 4-(hydroxymethyl)-3-(2,2,3,3-tetrafluoropropyl)-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 106290827 |
| Molecular Formula | C7H8F4N2OS |
| Molecular Weight | 244.21 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | 4-(hydroxymethyl)-3-(2,2,3,3-tetrafluoropropyl)-1H-imidazole-2-thione |
| SMILES | OCc1c[nH]c(=S)n1CC(F)(F)C(F)F |
| InChI | InChI=1S/C7H8F4N2OS/c8-5(9)7(10,11)3-13-4(2-14)1-12-6(13)15/h1,5,14H,2-3H2,(H,12,15) |
| InChIKey | BVACYQZHAXGEEX-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 40.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.21 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|