C9H13F3N2OS — CID 115522962
4-(hydroxymethyl)-3-(5,5,5-trifluoropentyl)-1H-imidazole-2-thione (PubChem CID 115522962) has the molecular formula C9H13F3N2OS and a molecular weight of 254.28 g/mol. Its IUPAC name is 4-(hydroxymethyl)-3-(5,5,5-trifluoropentyl)-1H-imidazole-2-thione.
| Compound Name | 4-(hydroxymethyl)-3-(5,5,5-trifluoropentyl)-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 115522962 |
| Molecular Formula | C9H13F3N2OS |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 4-(hydroxymethyl)-3-(5,5,5-trifluoropentyl)-1H-imidazole-2-thione |
| SMILES | OCc1c[nH]c(=S)n1CCCCC(F)(F)F |
| InChI | InChI=1S/C9H13F3N2OS/c10-9(11,12)3-1-2-4-14-7(6-15)5-13-8(14)16/h5,15H,1-4,6H2,(H,13,16) |
| InChIKey | IUUMUCKLLVFQCQ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 40.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|