C15H26N4O2 — CID 125192386
(4aR,8aS)-4-(2-methoxyethyl)-6-[(3-methylimidazol-4-yl)methyl]-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine (PubChem CID 125192386) has the molecular formula C15H26N4O2 and a molecular weight of 294.40 g/mol. Its IUPAC name is (4aR,8aS)-4-(2-methoxyethyl)-6-[(3-methylimidazol-4-yl)methyl]-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine.
| Compound Name | (4aR,8aS)-4-(2-methoxyethyl)-6-[(3-methylimidazol-4-yl)methyl]-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine |
|---|---|
| PubChem CID | 125192386 |
| Molecular Formula | C15H26N4O2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | (4aR,8aS)-4-(2-methoxyethyl)-6-[(3-methylimidazol-4-yl)methyl]-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine |
| SMILES | COCCN1CCO[C@H]2CCN(Cc3cncn3C)C[C@H]21 |
| InChI | InChI=1S/C15H26N4O2/c1-17-12-16-9-13(17)10-18-4-3-15-14(11-18)19(5-7-20-2)6-8-21-15/h9,12,14-15H,3-8,10-11H2,1-2H3/t14-,15+/m1/s1 |
| InChIKey | NDLNBBLOMLATPD-CABCVRRESA-N |
| XLogP | 0.34 |
| TPSA | 42.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |