C18H13F6N3 — CID 12520993
1-methyl-4,6-diphenyl-2,2-bis(trifluoromethyl)-1,3,5-triazine (PubChem CID 12520993) has the molecular formula C18H13F6N3 and a molecular weight of 385.31 g/mol. Its IUPAC name is 1-methyl-4,6-diphenyl-2,2-bis(trifluoromethyl)-1,3,5-triazine.
| Compound Name | 1-methyl-4,6-diphenyl-2,2-bis(trifluoromethyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 12520993 |
| Molecular Formula | C18H13F6N3 |
| Molecular Weight | 385.31 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 1-methyl-4,6-diphenyl-2,2-bis(trifluoromethyl)-1,3,5-triazine |
| SMILES | CN1C(c2ccccc2)=NC(c2ccccc2)=NC1(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H13F6N3/c1-27-15(13-10-6-3-7-11-13)25-14(12-8-4-2-5-9-12)26-16(27,17(19,20)21)18(22,23)24/h2-11H,1H3 |
| InChIKey | HSJNXFQOYJHAMC-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.31 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |