C13H19N5O3 — CID 125216177
(3R,3aS,7aS)-3-[(1-methylimidazole-2-carbonyl)amino]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-1-carboxamide (PubChem CID 125216177) has the molecular formula C13H19N5O3 and a molecular weight of 293.33 g/mol. Its IUPAC name is (3R,3aS,7aS)-3-[(1-methylimidazole-2-carbonyl)amino]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-1-carboxamide.
| Compound Name | (3R,3aS,7aS)-3-[(1-methylimidazole-2-carbonyl)amino]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-1-carboxamide |
|---|---|
| PubChem CID | 125216177 |
| Molecular Formula | C13H19N5O3 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | (3R,3aS,7aS)-3-[(1-methylimidazole-2-carbonyl)amino]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-1-carboxamide |
| SMILES | Cn1ccnc1C(=O)N[C@@H]1CN(C(N)=O)[C@H]2CCCO[C@@H]12 |
| InChI | InChI=1S/C13H19N5O3/c1-17-5-4-15-11(17)12(19)16-8-7-18(13(14)20)9-3-2-6-21-10(8)9/h4-5,8-10H,2-3,6-7H2,1H3,(H2,14,20)(H,16,19)/t8-,9+,10+/m1/s1 |
| InChIKey | AVPDVFJVWVJSDF-UTLUCORTSA-N |
| XLogP | -0.54 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |