C23H34N4O3 — CID 125227524
(3aR,6aS)-N-(4-ethylphenyl)-5-(2-methoxyethyl)-2-methyl-1-oxospiro[3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,4'-piperidine]-1'-carboxamide (PubChem CID 125227524) has the molecular formula C23H34N4O3 and a molecular weight of 414.55 g/mol. Its IUPAC name is (3aR,6aS)-N-(4-ethylphenyl)-5-(2-methoxyethyl)-2-methyl-1-oxospiro[3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,4'-piperidine]-1'-carboxamide.
| Compound Name | (3aR,6aS)-N-(4-ethylphenyl)-5-(2-methoxyethyl)-2-methyl-1-oxospiro[3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,4'-piperidine]-1'-carboxamide |
|---|---|
| PubChem CID | 125227524 |
| Molecular Formula | C23H34N4O3 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | (3aR,6aS)-N-(4-ethylphenyl)-5-(2-methoxyethyl)-2-methyl-1-oxospiro[3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,4'-piperidine]-1'-carboxamide |
| SMILES | CCc1ccc(NC(=O)N2CCC3(CC2)[C@H]2CN(CCOC)C[C@H]2C(=O)N3C)cc1 |
| InChI | InChI=1S/C23H34N4O3/c1-4-17-5-7-18(8-6-17)24-22(29)27-11-9-23(10-12-27)20-16-26(13-14-30-3)15-19(20)21(28)25(23)2/h5-8,19-20H,4,9-16H2,1-3H3,(H,24,29)/t19-,20+/m1/s1 |
| InChIKey | FKUBAWBSQNCFBK-UXHICEINSA-N |
| XLogP | 2.28 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |