C24H35N5O3 — CID 125227195
(3aR,6aS)-5-ethyl-1-N'-(4-ethylphenyl)-2-N,2-N-dimethyl-6-oxospiro[1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,4'-piperidine]-1',2-dicarboxamide (PubChem CID 125227195) has the molecular formula C24H35N5O3 and a molecular weight of 441.58 g/mol. Its IUPAC name is (3aR,6aS)-5-ethyl-1-N'-(4-ethylphenyl)-2-N,2-N-dimethyl-6-oxospiro[1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,4'-piperidine]-1',2-dicarboxamide.
| Compound Name | (3aR,6aS)-5-ethyl-1-N'-(4-ethylphenyl)-2-N,2-N-dimethyl-6-oxospiro[1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,4'-piperidine]-1',2-dicarboxamide |
|---|---|
| PubChem CID | 125227195 |
| Molecular Formula | C24H35N5O3 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.27 |
| IUPAC Name | (3aR,6aS)-5-ethyl-1-N'-(4-ethylphenyl)-2-N,2-N-dimethyl-6-oxospiro[1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,4'-piperidine]-1',2-dicarboxamide |
| SMILES | CCc1ccc(NC(=O)N2CCC3(CC2)[C@H]2CN(C(=O)N(C)C)C[C@H]2C(=O)N3CC)cc1 |
| InChI | InChI=1S/C24H35N5O3/c1-5-17-7-9-18(10-8-17)25-22(31)27-13-11-24(12-14-27)20-16-28(23(32)26(3)4)15-19(20)21(30)29(24)6-2/h7-10,19-20H,5-6,11-16H2,1-4H3,(H,25,31)/t19-,20+/m1/s1 |
| InChIKey | FAMNPUGDHBYBCE-UXHICEINSA-N |
| XLogP | 2.71 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |