C21H28N4O4 — CID 125234117
(3aR,6aS)-5-acetyl-N-(3-methoxyphenyl)-2-methyl-1-oxospiro[3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,4'-piperidine]-1'-carboxamide (PubChem CID 125234117) has the molecular formula C21H28N4O4 and a molecular weight of 400.48 g/mol. Its IUPAC name is (3aR,6aS)-5-acetyl-N-(3-methoxyphenyl)-2-methyl-1-oxospiro[3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,4'-piperidine]-1'-carboxamide.
| Compound Name | (3aR,6aS)-5-acetyl-N-(3-methoxyphenyl)-2-methyl-1-oxospiro[3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,4'-piperidine]-1'-carboxamide |
|---|---|
| PubChem CID | 125234117 |
| Molecular Formula | C21H28N4O4 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | (3aR,6aS)-5-acetyl-N-(3-methoxyphenyl)-2-methyl-1-oxospiro[3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,4'-piperidine]-1'-carboxamide |
| SMILES | COc1cccc(NC(=O)N2CCC3(CC2)[C@H]2CN(C(C)=O)C[C@H]2C(=O)N3C)c1 |
| InChI | InChI=1S/C21H28N4O4/c1-14(26)25-12-17-18(13-25)21(23(2)19(17)27)7-9-24(10-8-21)20(28)22-15-5-4-6-16(11-15)29-3/h4-6,11,17-18H,7-10,12-13H2,1-3H3,(H,22,28)/t17-,18+/m1/s1 |
| InChIKey | VXMMCNXVNXXQLT-MSOLQXFVSA-N |
| XLogP | 1.63 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |