C8H14S2 — CID 12524549
2-methyl-2-prop-2-enyl-1,3-dithiane (PubChem CID 12524549) has the molecular formula C8H14S2 and a molecular weight of 174.33 g/mol. Its IUPAC name is 2-methyl-2-prop-2-enyl-1,3-dithiane.
| Compound Name | 2-methyl-2-prop-2-enyl-1,3-dithiane |
|---|---|
| PubChem CID | 12524549 |
| Molecular Formula | C8H14S2 |
| Molecular Weight | 174.33 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | 2-methyl-2-prop-2-enyl-1,3-dithiane |
| SMILES | C=CCC1(C)SCCCS1 |
| InChI | InChI=1S/C8H14S2/c1-3-5-8(2)9-6-4-7-10-8/h3H,1,4-7H2,2H3 |
| InChIKey | ULZNPHNCLLVNCD-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|