C8H14S3 — CID 91750626
1-(4-methyl-4H-1,3-dithiin-2-yl)propane-2-thiol (PubChem CID 91750626) has the molecular formula C8H14S3 and a molecular weight of 206.40 g/mol. Its IUPAC name is 1-(4-methyl-4H-1,3-dithiin-2-yl)propane-2-thiol.
| Compound Name | 1-(4-methyl-4H-1,3-dithiin-2-yl)propane-2-thiol |
|---|---|
| PubChem CID | 91750626 |
| Molecular Formula | C8H14S3 |
| Molecular Weight | 206.40 g/mol |
| Exact Mass | 206.03 |
| IUPAC Name | 1-(4-methyl-4H-1,3-dithiin-2-yl)propane-2-thiol |
| SMILES | CC(S)CC1SC=CC(C)S1 |
| InChI | InChI=1S/C8H14S3/c1-6(9)5-8-10-4-3-7(2)11-8/h3-4,6-9H,5H2,1-2H3 |
| InChIKey | KIZYPBJKLBKTGJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|