C14H20FN5O2 — CID 125245838
3-[[(3R,3aR,6aR)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]-1,1-dimethylurea (PubChem CID 125245838) has the molecular formula C14H20FN5O2 and a molecular weight of 309.35 g/mol. Its IUPAC name is 3-[[(3R,3aR,6aR)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]-1,1-dimethylurea.
| Compound Name | 3-[[(3R,3aR,6aR)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 125245838 |
| Molecular Formula | C14H20FN5O2 |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 3-[[(3R,3aR,6aR)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NC[C@@H]1CO[C@H]2CN(c3ncc(F)cn3)C[C@@H]12 |
| InChI | InChI=1S/C14H20FN5O2/c1-19(2)14(21)18-3-9-8-22-12-7-20(6-11(9)12)13-16-4-10(15)5-17-13/h4-5,9,11-12H,3,6-8H2,1-2H3,(H,18,21)/t9-,11+,12+/m1/s1 |
| InChIKey | OSIPWLUIAKUWHF-USWWRNFRSA-N |
| XLogP | 0.34 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |