C12H20N4O10S2 — CID 12525952
tetraethyl 1,4-dioxo-1,4,2,3,5,6-dithiatetrazinane-2,3,5,6-tetracarboxylate (PubChem CID 12525952) has the molecular formula C12H20N4O10S2 and a molecular weight of 444.44 g/mol. Its IUPAC name is tetraethyl 1,4-dioxo-1,4,2,3,5,6-dithiatetrazinane-2,3,5,6-tetracarboxylate.
| Compound Name | tetraethyl 1,4-dioxo-1,4,2,3,5,6-dithiatetrazinane-2,3,5,6-tetracarboxylate |
|---|---|
| PubChem CID | 12525952 |
| Molecular Formula | C12H20N4O10S2 |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | tetraethyl 1,4-dioxo-1,4,2,3,5,6-dithiatetrazinane-2,3,5,6-tetracarboxylate |
| SMILES | CCOC(=O)N1N(C(=O)OCC)S(=O)N(C(=O)OCC)N(C(=O)OCC)S1=O |
| InChI | InChI=1S/C12H20N4O10S2/c1-5-23-9(17)13-14(10(18)24-6-2)28(22)16(12(20)26-8-4)15(27(13)21)11(19)25-7-3/h5-8H2,1-4H3 |
| InChIKey | GUIKTGDGGHFRFT-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 152.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|