C8H13FN2O — CID 125261922
(3aR,7aS)-3a-fluoro-2-methyl-1,3,5,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one (PubChem CID 125261922) has the molecular formula C8H13FN2O and a molecular weight of 172.20 g/mol. Its IUPAC name is (3aR,7aS)-3a-fluoro-2-methyl-1,3,5,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one.
| Compound Name | (3aR,7aS)-3a-fluoro-2-methyl-1,3,5,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one |
|---|---|
| PubChem CID | 125261922 |
| Molecular Formula | C8H13FN2O |
| Molecular Weight | 172.20 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | (3aR,7aS)-3a-fluoro-2-methyl-1,3,5,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one |
| SMILES | CN1C[C@@H]2CCNC(=O)[C@]2(F)C1 |
| InChI | InChI=1S/C8H13FN2O/c1-11-4-6-2-3-10-7(12)8(6,9)5-11/h6H,2-5H2,1H3,(H,10,12)/t6-,8-/m0/s1 |
| InChIKey | XRHVIULYESBVCJ-XPUUQOCRSA-N |
| XLogP | -0.22 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.20 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |