C19H20N4 — CID 12526552
5-benzyl-4-N,6-N-dimethyl-2-phenylpyrimidine-4,6-diamine (PubChem CID 12526552) has the molecular formula C19H20N4 and a molecular weight of 304.40 g/mol. Its IUPAC name is 5-benzyl-4-N,6-N-dimethyl-2-phenylpyrimidine-4,6-diamine.
| Compound Name | 5-benzyl-4-N,6-N-dimethyl-2-phenylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 12526552 |
| Molecular Formula | C19H20N4 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 5-benzyl-4-N,6-N-dimethyl-2-phenylpyrimidine-4,6-diamine |
| SMILES | CNc1nc(-c2ccccc2)nc(NC)c1Cc1ccccc1 |
| InChI | InChI=1S/C19H20N4/c1-20-18-16(13-14-9-5-3-6-10-14)19(21-2)23-17(22-18)15-11-7-4-8-12-15/h3-12H,13H2,1-2H3,(H2,20,21,22,23) |
| InChIKey | XXUUAOPXZVSEIL-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |