C20H16N2OS — CID 1252760
1-(2-methyl-1H-indol-3-yl)-2-quinolin-2-ylsulfanylethanone (PubChem CID 1252760) has the molecular formula C20H16N2OS and a molecular weight of 332.43 g/mol. Its IUPAC name is 1-(2-methyl-1H-indol-3-yl)-2-quinolin-2-ylsulfanylethanone.
| Compound Name | 1-(2-methyl-1H-indol-3-yl)-2-quinolin-2-ylsulfanylethanone |
|---|---|
| PubChem CID | 1252760 |
| Molecular Formula | C20H16N2OS |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 1-(2-methyl-1H-indol-3-yl)-2-quinolin-2-ylsulfanylethanone |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)CSc1ccc2ccccc2n1 |
| InChI | InChI=1S/C20H16N2OS/c1-13-20(15-7-3-5-9-17(15)21-13)18(23)12-24-19-11-10-14-6-2-4-8-16(14)22-19/h2-11,21H,12H2,1H3 |
| InChIKey | YXFFGGXASQALOZ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |