C25H18ClN3OS — CID 3827614
2-(6-chloro-4-phenylquinazolin-2-yl)sulfanyl-1-(2-methyl-1H-indol-3-yl)ethanone (PubChem CID 3827614) has the molecular formula C25H18ClN3OS and a molecular weight of 443.96 g/mol. Its IUPAC name is 2-(6-chloro-4-phenylquinazolin-2-yl)sulfanyl-1-(2-methyl-1H-indol-3-yl)ethanone.
| Compound Name | 2-(6-chloro-4-phenylquinazolin-2-yl)sulfanyl-1-(2-methyl-1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 3827614 |
| Molecular Formula | C25H18ClN3OS |
| Molecular Weight | 443.96 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | 2-(6-chloro-4-phenylquinazolin-2-yl)sulfanyl-1-(2-methyl-1H-indol-3-yl)ethanone |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)CSc1nc(-c2ccccc2)c2cc(Cl)ccc2n1 |
| InChI | InChI=1S/C25H18ClN3OS/c1-15-23(18-9-5-6-10-20(18)27-15)22(30)14-31-25-28-21-12-11-17(26)13-19(21)24(29-25)16-7-3-2-4-8-16/h2-13,27H,14H2,1H3 |
| InChIKey | WZFMQTNJAZPLHO-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.96 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |