About 2-[(4-chlorophenyl)methyl-methylamino]ethyl 3-oxobutanoate
2-[(4-chlorophenyl)methyl-methylamino]ethyl 3-oxobutanoate (PubChem CID 12529177) has the molecular formula C14H18ClNO3
and a molecular weight of 283.76 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl-methylamino]ethyl 3-oxobutanoate.
Molecular Properties
| Compound Name | 2-[(4-chlorophenyl)methyl-methylamino]ethyl 3-oxobutanoate |
| PubChem CID | 12529177 |
| Molecular Formula | C14H18ClNO3 |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl-methylamino]ethyl 3-oxobutanoate |
| SMILES | CC(=O)CC(=O)OCCN(C)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H18ClNO3/c1-11(17)9-14(18)19-8-7-16(2)10-12-3-5-13(15)6-4-12/h3-6H,7-10H2,1-2H3 |
| InChIKey | BLDBBORBEXWVEJ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4-chlorophenyl)methyl-methylamino]ethyl 3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-chlorophenyl)methyl-methylamino]ethyl 3-oxobutanoate?
The IUPAC name of 2-[(4-chlorophenyl)methyl-methylamino]ethyl 3-oxobutanoate (CID 12529177) is 2-[(4-chlorophenyl)methyl-methylamino]ethyl 3-oxobutanoate.
What is the SMILES notation for 2-[(4-chlorophenyl)methyl-methylamino]ethyl 3-oxobutanoate?
The canonical SMILES for 2-[(4-chlorophenyl)methyl-methylamino]ethyl 3-oxobutanoate is CC(=O)CC(=O)OCCN(C)Cc1ccc(Cl)cc1.
What is the InChIKey of 2-[(4-chlorophenyl)methyl-methylamino]ethyl 3-oxobutanoate?
The InChIKey is BLDBBORBEXWVEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18ClNO3/c1-11(17)9-14(18)19-8-7-16(2)10-12-3-5-13(15)6-4-12/h3-6H,7-10H2,1-2H3.
What are the key properties of 2-[(4-chlorophenyl)methyl-methylamino]ethyl 3-oxobutanoate?
2-[(4-chlorophenyl)methyl-methylamino]ethyl 3-oxobutanoate has a molecular weight of 283.76 g/mol, XLogP of 2.29, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-chlorophenyl)methyl-methylamino]ethyl 3-oxobutanoate is sourced from PubChem (CID 12529177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).