C17H19ClN2O2 — CID 24836409
2-[benzyl(methyl)amino]ethyl N-(4-chlorophenyl)carbamate (PubChem CID 24836409) has the molecular formula C17H19ClN2O2 and a molecular weight of 318.80 g/mol. Its IUPAC name is 2-[benzyl(methyl)amino]ethyl N-(4-chlorophenyl)carbamate.
| Compound Name | 2-[benzyl(methyl)amino]ethyl N-(4-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 24836409 |
| Molecular Formula | C17H19ClN2O2 |
| Molecular Weight | 318.80 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 2-[benzyl(methyl)amino]ethyl N-(4-chlorophenyl)carbamate |
| SMILES | CN(CCOC(=O)Nc1ccc(Cl)cc1)Cc1ccccc1 |
| InChI | InChI=1S/C17H19ClN2O2/c1-20(13-14-5-3-2-4-6-14)11-12-22-17(21)19-16-9-7-15(18)8-10-16/h2-10H,11-13H2,1H3,(H,19,21) |
| InChIKey | XZWNEZFAMXDTFB-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.80 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |