About ethyl 7-azaspiro[3.5]nona-5,8-diene-7-carboxylate
ethyl 7-azaspiro[3.5]nona-5,8-diene-7-carboxylate (PubChem CID 12530988) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is ethyl 7-azaspiro[3.5]nona-5,8-diene-7-carboxylate.
Molecular Properties
| Compound Name | ethyl 7-azaspiro[3.5]nona-5,8-diene-7-carboxylate |
| PubChem CID | 12530988 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | ethyl 7-azaspiro[3.5]nona-5,8-diene-7-carboxylate |
| SMILES | CCOC(=O)N1C=CC2(C=C1)CCC2 |
| InChI | InChI=1S/C11H15NO2/c1-2-14-10(13)12-8-6-11(7-9-12)4-3-5-11/h6-9H,2-5H2,1H3 |
| InChIKey | GIZBOASXLXLMAW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethyl 7-azaspiro[3.5]nona-5,8-diene-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 7-azaspiro[3.5]nona-5,8-diene-7-carboxylate?
The IUPAC name of ethyl 7-azaspiro[3.5]nona-5,8-diene-7-carboxylate (CID 12530988) is ethyl 7-azaspiro[3.5]nona-5,8-diene-7-carboxylate.
What is the SMILES notation for ethyl 7-azaspiro[3.5]nona-5,8-diene-7-carboxylate?
The canonical SMILES for ethyl 7-azaspiro[3.5]nona-5,8-diene-7-carboxylate is CCOC(=O)N1C=CC2(C=C1)CCC2.
What is the InChIKey of ethyl 7-azaspiro[3.5]nona-5,8-diene-7-carboxylate?
The InChIKey is GIZBOASXLXLMAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2/c1-2-14-10(13)12-8-6-11(7-9-12)4-3-5-11/h6-9H,2-5H2,1H3.
What are the key properties of ethyl 7-azaspiro[3.5]nona-5,8-diene-7-carboxylate?
ethyl 7-azaspiro[3.5]nona-5,8-diene-7-carboxylate has a molecular weight of 193.25 g/mol, XLogP of 2.66, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 7-azaspiro[3.5]nona-5,8-diene-7-carboxylate is sourced from PubChem (CID 12530988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).