C10H13NO2 — CID 12530992
ethyl 6-azaspiro[2.5]octa-4,7-diene-6-carboxylate (PubChem CID 12530992) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is ethyl 6-azaspiro[2.5]octa-4,7-diene-6-carboxylate.
| Compound Name | ethyl 6-azaspiro[2.5]octa-4,7-diene-6-carboxylate |
|---|---|
| PubChem CID | 12530992 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | ethyl 6-azaspiro[2.5]octa-4,7-diene-6-carboxylate |
| SMILES | CCOC(=O)N1C=CC2(C=C1)CC2 |
| InChI | InChI=1S/C10H13NO2/c1-2-13-9(12)11-7-5-10(3-4-10)6-8-11/h5-8H,2-4H2,1H3 |
| InChIKey | LARLCTFQWJMKAI-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |