About 1-methylpyrrol-3-amine
1-methylpyrrol-3-amine (PubChem CID 12532405) has the molecular formula C5H8N2
and a molecular weight of 96.13 g/mol. Its IUPAC name is 1-methylpyrrol-3-amine.
Molecular Properties
| Compound Name | 1-methylpyrrol-3-amine |
| PubChem CID | 12532405 |
| Molecular Formula | C5H8N2 |
| Molecular Weight | 96.13 g/mol |
| Exact Mass | 96.07 |
| IUPAC Name | 1-methylpyrrol-3-amine |
| SMILES | Cn1ccc(N)c1 |
| InChI | InChI=1S/C5H8N2/c1-7-3-2-5(6)4-7/h2-4H,6H2,1H3 |
| InChIKey | GDQSDZRZHLAVCU-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 96.13 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methylpyrrol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpyrrol-3-amine?
The IUPAC name of 1-methylpyrrol-3-amine (CID 12532405) is 1-methylpyrrol-3-amine.
What is the SMILES notation for 1-methylpyrrol-3-amine?
The canonical SMILES for 1-methylpyrrol-3-amine is Cn1ccc(N)c1.
What is the InChIKey of 1-methylpyrrol-3-amine?
The InChIKey is GDQSDZRZHLAVCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2/c1-7-3-2-5(6)4-7/h2-4H,6H2,1H3.
What are the key properties of 1-methylpyrrol-3-amine?
1-methylpyrrol-3-amine has a molecular weight of 96.13 g/mol, XLogP of 0.61, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpyrrol-3-amine is sourced from PubChem (CID 12532405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).