C17H17N — CID 12533749
17-methyl-17-azatetracyclo[8.6.1.02,7.011,16]heptadeca-2,4,6,11,13,15-hexaene (PubChem CID 12533749) has the molecular formula C17H17N and a molecular weight of 235.33 g/mol. Its IUPAC name is 17-methyl-17-azatetracyclo[8.6.1.02,7.011,16]heptadeca-2,4,6,11,13,15-hexaene.
| Compound Name | 17-methyl-17-azatetracyclo[8.6.1.02,7.011,16]heptadeca-2,4,6,11,13,15-hexaene |
|---|---|
| PubChem CID | 12533749 |
| Molecular Formula | C17H17N |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 17-methyl-17-azatetracyclo[8.6.1.02,7.011,16]heptadeca-2,4,6,11,13,15-hexaene |
| SMILES | CN1C2CCc3ccccc3C1c1ccccc12 |
| InChI | InChI=1S/C17H17N/c1-18-16-11-10-12-6-2-3-7-13(12)17(18)15-9-5-4-8-14(15)16/h2-9,16-17H,10-11H2,1H3 |
| InChIKey | UBLNRDNAFCSEDA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |