About 8-methyl-2,3-diphenyl-8-azabicyclo[3.2.1]oct-2-ene
8-methyl-2,3-diphenyl-8-azabicyclo[3.2.1]oct-2-ene (PubChem CID 21220480) has the molecular formula C20H21N
and a molecular weight of 275.40 g/mol. Its IUPAC name is 8-methyl-2,3-diphenyl-8-azabicyclo[3.2.1]oct-2-ene.
Molecular Properties
| Compound Name | 8-methyl-2,3-diphenyl-8-azabicyclo[3.2.1]oct-2-ene |
| PubChem CID | 21220480 |
| Molecular Formula | C20H21N |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 8-methyl-2,3-diphenyl-8-azabicyclo[3.2.1]oct-2-ene |
| SMILES | CN1C2CCC1C(c1ccccc1)=C(c1ccccc1)C2 |
| InChI | InChI=1S/C20H21N/c1-21-17-12-13-19(21)20(16-10-6-3-7-11-16)18(14-17)15-8-4-2-5-9-15/h2-11,17,19H,12-14H2,1H3 |
| InChIKey | MQNDOATZDZDAHT-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 8-methyl-2,3-diphenyl-8-azabicyclo[3.2.1]oct-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-2,3-diphenyl-8-azabicyclo[3.2.1]oct-2-ene?
The IUPAC name of 8-methyl-2,3-diphenyl-8-azabicyclo[3.2.1]oct-2-ene (CID 21220480) is 8-methyl-2,3-diphenyl-8-azabicyclo[3.2.1]oct-2-ene.
What is the SMILES notation for 8-methyl-2,3-diphenyl-8-azabicyclo[3.2.1]oct-2-ene?
The canonical SMILES for 8-methyl-2,3-diphenyl-8-azabicyclo[3.2.1]oct-2-ene is CN1C2CCC1C(c1ccccc1)=C(c1ccccc1)C2.
What is the InChIKey of 8-methyl-2,3-diphenyl-8-azabicyclo[3.2.1]oct-2-ene?
The InChIKey is MQNDOATZDZDAHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N/c1-21-17-12-13-19(21)20(16-10-6-3-7-11-16)18(14-17)15-8-4-2-5-9-15/h2-11,17,19H,12-14H2,1H3.
What are the key properties of 8-methyl-2,3-diphenyl-8-azabicyclo[3.2.1]oct-2-ene?
8-methyl-2,3-diphenyl-8-azabicyclo[3.2.1]oct-2-ene has a molecular weight of 275.40 g/mol, XLogP of 4.46, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-2,3-diphenyl-8-azabicyclo[3.2.1]oct-2-ene is sourced from PubChem (CID 21220480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).