C19H14Br2N2O5 — CID 1253490
6-bromo-N'-[(2R)-2-(4-bromophenoxy)propanoyl]-2-oxochromene-3-carbohydrazide (PubChem CID 1253490) has the molecular formula C19H14Br2N2O5 and a molecular weight of 510.14 g/mol. Its IUPAC name is 6-bromo-N'-[(2R)-2-(4-bromophenoxy)propanoyl]-2-oxochromene-3-carbohydrazide.
| Compound Name | 6-bromo-N'-[(2R)-2-(4-bromophenoxy)propanoyl]-2-oxochromene-3-carbohydrazide |
|---|---|
| PubChem CID | 1253490 |
| Molecular Formula | C19H14Br2N2O5 |
| Molecular Weight | 510.14 g/mol |
| Exact Mass | 507.93 |
| IUPAC Name | 6-bromo-N'-[(2R)-2-(4-bromophenoxy)propanoyl]-2-oxochromene-3-carbohydrazide |
| SMILES | C[C@@H](Oc1ccc(Br)cc1)C(=O)NNC(=O)c1cc2cc(Br)ccc2oc1=O |
| InChI | InChI=1S/C19H14Br2N2O5/c1-10(27-14-5-2-12(20)3-6-14)17(24)22-23-18(25)15-9-11-8-13(21)4-7-16(11)28-19(15)26/h2-10H,1H3,(H,22,24)(H,23,25)/t10-/m1/s1 |
| InChIKey | NRMYYLQPINWUEP-SNVBAGLBSA-N |
| XLogP | 3.55 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.14 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|