C26H21BrN2O6 — CID 996211
6-bromo-2-oxo-N'-[(2R)-2-(4-phenylmethoxyphenoxy)propanoyl]chromene-3-carbohydrazide (PubChem CID 996211) has the molecular formula C26H21BrN2O6 and a molecular weight of 537.37 g/mol. Its IUPAC name is 6-bromo-2-oxo-N'-[(2R)-2-(4-phenylmethoxyphenoxy)propanoyl]chromene-3-carbohydrazide.
| Compound Name | 6-bromo-2-oxo-N'-[(2R)-2-(4-phenylmethoxyphenoxy)propanoyl]chromene-3-carbohydrazide |
|---|---|
| PubChem CID | 996211 |
| Molecular Formula | C26H21BrN2O6 |
| Molecular Weight | 537.37 g/mol |
| Exact Mass | 536.06 |
| IUPAC Name | 6-bromo-2-oxo-N'-[(2R)-2-(4-phenylmethoxyphenoxy)propanoyl]chromene-3-carbohydrazide |
| SMILES | C[C@@H](Oc1ccc(OCc2ccccc2)cc1)C(=O)NNC(=O)c1cc2cc(Br)ccc2oc1=O |
| InChI | InChI=1S/C26H21BrN2O6/c1-16(34-21-10-8-20(9-11-21)33-15-17-5-3-2-4-6-17)24(30)28-29-25(31)22-14-18-13-19(27)7-12-23(18)35-26(22)32/h2-14,16H,15H2,1H3,(H,28,30)(H,29,31)/t16-/m1/s1 |
| InChIKey | LHZYUJQOUMJJMV-MRXNPFEDSA-N |
| XLogP | 4.36 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.37 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|