C29H26N2O4 — CID 4952061
2-phenylmethoxy-N'-[2-(4-phenylphenoxy)propanoyl]benzohydrazide (PubChem CID 4952061) has the molecular formula C29H26N2O4 and a molecular weight of 466.54 g/mol. Its IUPAC name is 2-phenylmethoxy-N'-[2-(4-phenylphenoxy)propanoyl]benzohydrazide.
| Compound Name | 2-phenylmethoxy-N'-[2-(4-phenylphenoxy)propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 4952061 |
| Molecular Formula | C29H26N2O4 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 2-phenylmethoxy-N'-[2-(4-phenylphenoxy)propanoyl]benzohydrazide |
| SMILES | CC(Oc1ccc(-c2ccccc2)cc1)C(=O)NNC(=O)c1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C29H26N2O4/c1-21(35-25-18-16-24(17-19-25)23-12-6-3-7-13-23)28(32)30-31-29(33)26-14-8-9-15-27(26)34-20-22-10-4-2-5-11-22/h2-19,21H,20H2,1H3,(H,30,32)(H,31,33) |
| InChIKey | XBOAUEDNSUJORA-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|