C28H32N2O4 — CID 17150849
N'-[2-(2-butan-2-ylphenoxy)butanoyl]-2-phenylmethoxybenzohydrazide (PubChem CID 17150849) has the molecular formula C28H32N2O4 and a molecular weight of 460.57 g/mol. Its IUPAC name is N'-[2-(2-butan-2-ylphenoxy)butanoyl]-2-phenylmethoxybenzohydrazide.
| Compound Name | N'-[2-(2-butan-2-ylphenoxy)butanoyl]-2-phenylmethoxybenzohydrazide |
|---|---|
| PubChem CID | 17150849 |
| Molecular Formula | C28H32N2O4 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | N'-[2-(2-butan-2-ylphenoxy)butanoyl]-2-phenylmethoxybenzohydrazide |
| SMILES | CCC(Oc1ccccc1C(C)CC)C(=O)NNC(=O)c1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C28H32N2O4/c1-4-20(3)22-15-9-12-18-26(22)34-24(5-2)28(32)30-29-27(31)23-16-10-11-17-25(23)33-19-21-13-7-6-8-14-21/h6-18,20,24H,4-5,19H2,1-3H3,(H,29,31)(H,30,32) |
| InChIKey | BCFVQPAMQMMZQZ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|