C34H49BrN4O5Si — CID 125358745
methyl (3S)-3-[[(2S)-2-[[(2R)-2-aminopropanoyl]-methylamino]-3-[(2S)-2-bromo-2H-indol-3-yl]propanoyl]amino]-3-[4-tri(propan-2-yl)silyloxyphenyl]propanoate (PubChem CID 125358745) has the molecular formula C34H49BrN4O5Si and a molecular weight of 701.78 g/mol. Its IUPAC name is methyl (3S)-3-[[(2S)-2-[[(2R)-2-aminopropanoyl]-methylamino]-3-[(2S)-2-bromo-2H-indol-3-yl]propanoyl]amino]-3-[4-tri(propan-2-yl)silyloxyphenyl]propanoate.
| Compound Name | methyl (3S)-3-[[(2S)-2-[[(2R)-2-aminopropanoyl]-methylamino]-3-[(2S)-2-bromo-2H-indol-3-yl]propanoyl]amino]-3-[4-tri(propan-2-yl)silyloxyphenyl]propanoate |
|---|---|
| PubChem CID | 125358745 |
| Molecular Formula | C34H49BrN4O5Si |
| Molecular Weight | 701.78 g/mol |
| Exact Mass | 700.27 |
| IUPAC Name | methyl (3S)-3-[[(2S)-2-[[(2R)-2-aminopropanoyl]-methylamino]-3-[(2S)-2-bromo-2H-indol-3-yl]propanoyl]amino]-3-[4-tri(propan-2-yl)silyloxyphenyl]propanoate |
| SMILES | COC(=O)C[C@H](NC(=O)[C@H](CC1=c2ccccc2=N[C@H]1Br)N(C)C(=O)[C@@H](C)N)c1ccc(O[Si](C(C)C)(C(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C34H49BrN4O5Si/c1-20(2)45(21(3)4,22(5)6)44-25-16-14-24(15-17-25)29(19-31(40)43-9)38-33(41)30(39(8)34(42)23(7)36)18-27-26-12-10-11-13-28(26)37-32(27)35/h10-17,20-23,29-30,32H,18-19,36H2,1-9H3,(H,38,41)/t23-,29+,30+,32-/m1/s1 |
| InChIKey | JSUGMPNRWODQPA-INPBIOJESA-N |
| XLogP | 4.73 |
| TPSA | 123.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.78 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|