C13H21BO — CID 12536901
5-methoxy-6-methyl-1,3-bis(prop-2-enyl)-3,4-dihydro-2H-borinine (PubChem CID 12536901) has the molecular formula C13H21BO and a molecular weight of 204.12 g/mol. Its IUPAC name is 5-methoxy-6-methyl-1,3-bis(prop-2-enyl)-3,4-dihydro-2H-borinine.
| Compound Name | 5-methoxy-6-methyl-1,3-bis(prop-2-enyl)-3,4-dihydro-2H-borinine |
|---|---|
| PubChem CID | 12536901 |
| Molecular Formula | C13H21BO |
| Molecular Weight | 204.12 g/mol |
| Exact Mass | 204.17 |
| IUPAC Name | 5-methoxy-6-methyl-1,3-bis(prop-2-enyl)-3,4-dihydro-2H-borinine |
| SMILES | C=CCB1CC(CC=C)CC(OC)=C1C |
| InChI | InChI=1S/C13H21BO/c1-5-7-12-9-13(15-4)11(3)14(10-12)8-6-2/h5-6,12H,1-2,7-10H2,3-4H3 |
| InChIKey | PNZVKTITCRMQBG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.12 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|