C12H19BO — CID 134890670
5-methoxy-1,3-bis(prop-2-enyl)-3,4-dihydro-2H-borinine (PubChem CID 134890670) has the molecular formula C12H19BO and a molecular weight of 190.09 g/mol. Its IUPAC name is 5-methoxy-1,3-bis(prop-2-enyl)-3,4-dihydro-2H-borinine.
| Compound Name | 5-methoxy-1,3-bis(prop-2-enyl)-3,4-dihydro-2H-borinine |
|---|---|
| PubChem CID | 134890670 |
| Molecular Formula | C12H19BO |
| Molecular Weight | 190.09 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 5-methoxy-1,3-bis(prop-2-enyl)-3,4-dihydro-2H-borinine |
| SMILES | C=CCB1C=C(OC)CC(CC=C)C1 |
| InChI | InChI=1S/C12H19BO/c1-4-6-11-8-12(14-3)10-13(9-11)7-5-2/h4-5,10-11H,1-2,6-9H2,3H3 |
| InChIKey | KNGPBBQPPKDYEI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.09 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|