C12H18 — CID 12536962
(1E,5Z)-1-cyclopropyl-5-methylcycloocta-1,5-diene (PubChem CID 12536962) has the molecular formula C12H18 and a molecular weight of 162.28 g/mol. Its IUPAC name is (1E,5Z)-1-cyclopropyl-5-methylcycloocta-1,5-diene.
| Compound Name | (1E,5Z)-1-cyclopropyl-5-methylcycloocta-1,5-diene |
|---|---|
| PubChem CID | 12536962 |
| Molecular Formula | C12H18 |
| Molecular Weight | 162.28 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | (1E,5Z)-1-cyclopropyl-5-methylcycloocta-1,5-diene |
| SMILES | C/C1=C/CC/C(C2CC2)=C\CC1 |
| InChI | InChI=1S/C12H18/c1-10-4-2-6-11(7-3-5-10)12-8-9-12/h4,7,12H,2-3,5-6,8-9H2,1H3/b10-4-,11-7+ |
| InChIKey | NLKPPZFANIVPLJ-NQEAYRSNSA-N |
| XLogP | 3.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.28 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|