C7H12BrNO — CID 12537186
2-bromo-N,N,1-trimethylcyclopropane-1-carboxamide (PubChem CID 12537186) has the molecular formula C7H12BrNO and a molecular weight of 206.08 g/mol. Its IUPAC name is 2-bromo-N,N,1-trimethylcyclopropane-1-carboxamide.
| Compound Name | 2-bromo-N,N,1-trimethylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 12537186 |
| Molecular Formula | C7H12BrNO |
| Molecular Weight | 206.08 g/mol |
| Exact Mass | 205.01 |
| IUPAC Name | 2-bromo-N,N,1-trimethylcyclopropane-1-carboxamide |
| SMILES | CN(C)C(=O)C1(C)CC1Br |
| InChI | InChI=1S/C7H12BrNO/c1-7(4-5(7)8)6(10)9(2)3/h5H,4H2,1-3H3 |
| InChIKey | IANZWHRIULQIMO-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.08 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|