C27H34O11 — CID 125395590
(2R,3S,4R,5R,6S)-2-[4-[(3R,3aS,6S,6aS)-3-(3,4-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-3-methoxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 125395590) has the molecular formula C27H34O11 and a molecular weight of 534.56 g/mol. Its IUPAC name is (2R,3S,4R,5R,6S)-2-[4-[(3R,3aS,6S,6aS)-3-(3,4-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-3-methoxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3S,4R,5R,6S)-2-[4-[(3R,3aS,6S,6aS)-3-(3,4-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-3-methoxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 125395590 |
| Molecular Formula | C27H34O11 |
| Molecular Weight | 534.56 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | (2R,3S,4R,5R,6S)-2-[4-[(3R,3aS,6S,6aS)-3-(3,4-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-3-methoxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | COc1ccc([C@@H]2OC[C@@H]3[C@H]2CO[C@@H]3c2ccc(O[C@H]3O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]3O)cc2OC)cc1OC |
| InChI | InChI=1S/C27H34O11/c1-32-18-7-4-13(8-20(18)34-3)25-16-11-36-26(17(16)12-35-25)15-6-5-14(9-19(15)33-2)37-27-24(31)23(30)22(29)21(10-28)38-27/h4-9,16-17,21-31H,10-12H2,1-3H3/t16-,17-,21+,22+,23-,24+,25+,26-,27+/m1/s1 |
| InChIKey | ZTIZEXUIEBLYBL-VEKDMQCOSA-N |
| XLogP | 0.97 |
| TPSA | 145.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.56 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |