C29H36N6O4 — CID 125415824
(14Z,16S,17S)-17-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-4-(pyrazine-2-carbonyl)-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6,8,10,14-tetraen-2-one (PubChem CID 125415824) has the molecular formula C29H36N6O4 and a molecular weight of 532.65 g/mol. Its IUPAC name is (14Z,16S,17S)-17-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-4-(pyrazine-2-carbonyl)-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6,8,10,14-tetraen-2-one.
| Compound Name | (14Z,16S,17S)-17-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-4-(pyrazine-2-carbonyl)-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6,8,10,14-tetraen-2-one |
|---|---|
| PubChem CID | 125415824 |
| Molecular Formula | C29H36N6O4 |
| Molecular Weight | 532.65 g/mol |
| Exact Mass | 532.28 |
| IUPAC Name | (14Z,16S,17S)-17-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-4-(pyrazine-2-carbonyl)-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6,8,10,14-tetraen-2-one |
| SMILES | CN1CCN(C(=O)C[C@@H]2CCN3C[C@@H]2/C=C\COc2ccccc2CN(C(=O)c2cnccn2)CC3=O)CC1 |
| InChI | InChI=1S/C29H36N6O4/c1-32-12-14-33(15-13-32)27(36)17-22-8-11-34-19-23(22)6-4-16-39-26-7-3-2-5-24(26)20-35(21-28(34)37)29(38)25-18-30-9-10-31-25/h2-7,9-10,18,22-23H,8,11-17,19-21H2,1H3/b6-4-/t22-,23-/m0/s1 |
| InChIKey | FUNLSYLTCODUGL-LIOVRKMKSA-N |
| XLogP | 1.70 |
| TPSA | 99.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.65 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|