C14H20O3 — CID 125416206
(4R)-4-[(1E,3E)-hepta-1,3-dienyl]-2-hydroxy-3-(hydroxymethyl)cyclohex-2-en-1-one (PubChem CID 125416206) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is (4R)-4-[(1E,3E)-hepta-1,3-dienyl]-2-hydroxy-3-(hydroxymethyl)cyclohex-2-en-1-one.
| Compound Name | (4R)-4-[(1E,3E)-hepta-1,3-dienyl]-2-hydroxy-3-(hydroxymethyl)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 125416206 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (4R)-4-[(1E,3E)-hepta-1,3-dienyl]-2-hydroxy-3-(hydroxymethyl)cyclohex-2-en-1-one |
| SMILES | CCC/C=C/C=C/[C@H]1CCC(=O)C(O)=C1CO |
| InChI | InChI=1S/C14H20O3/c1-2-3-4-5-6-7-11-8-9-13(16)14(17)12(11)10-15/h4-7,11,15,17H,2-3,8-10H2,1H3/b5-4+,7-6+/t11-/m0/s1 |
| InChIKey | JSLMNXFCDHWCGJ-YMMJRAIESA-N |
| XLogP | 2.68 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|