C13H21BrN2O2S — CID 125419034
(2S)-2-(4-bromothiophen-2-yl)-2-(dimethylamino)-N-(3-ethoxypropyl)acetamide (PubChem CID 125419034) has the molecular formula C13H21BrN2O2S and a molecular weight of 349.29 g/mol. Its IUPAC name is (2S)-2-(4-bromothiophen-2-yl)-2-(dimethylamino)-N-(3-ethoxypropyl)acetamide.
| Compound Name | (2S)-2-(4-bromothiophen-2-yl)-2-(dimethylamino)-N-(3-ethoxypropyl)acetamide |
|---|---|
| PubChem CID | 125419034 |
| Molecular Formula | C13H21BrN2O2S |
| Molecular Weight | 349.29 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | (2S)-2-(4-bromothiophen-2-yl)-2-(dimethylamino)-N-(3-ethoxypropyl)acetamide |
| SMILES | CCOCCCNC(=O)[C@@H](c1cc(Br)cs1)N(C)C |
| InChI | InChI=1S/C13H21BrN2O2S/c1-4-18-7-5-6-15-13(17)12(16(2)3)11-8-10(14)9-19-11/h8-9,12H,4-7H2,1-3H3,(H,15,17)/t12-/m1/s1 |
| InChIKey | UFNDSSPVGOLHNQ-GFCCVEGCSA-N |
| XLogP | 2.66 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.29 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|