C16H17N3O4 — CID 125419283
N-[3-[5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-yl]propyl]cyclopropanecarboxamide (PubChem CID 125419283) has the molecular formula C16H17N3O4 and a molecular weight of 315.33 g/mol. Its IUPAC name is N-[3-[5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-yl]propyl]cyclopropanecarboxamide.
| Compound Name | N-[3-[5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-yl]propyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 125419283 |
| Molecular Formula | C16H17N3O4 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | N-[3-[5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-yl]propyl]cyclopropanecarboxamide |
| SMILES | O=C(NCCCc1nnc(-c2ccc3c(c2)OCO3)o1)C1CC1 |
| InChI | InChI=1S/C16H17N3O4/c20-15(10-3-4-10)17-7-1-2-14-18-19-16(23-14)11-5-6-12-13(8-11)22-9-21-12/h5-6,8,10H,1-4,7,9H2,(H,17,20) |
| InChIKey | LCAZDWUGPUGYJY-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|