C13H12F3N5O2 — CID 125420689
1-methyl-5-[2-nitro-4-(trifluoromethyl)phenyl]-4,6-dihydropyrrolo[3,4-d]pyrazol-3-amine (PubChem CID 125420689) has the molecular formula C13H12F3N5O2 and a molecular weight of 327.27 g/mol. Its IUPAC name is 1-methyl-5-[2-nitro-4-(trifluoromethyl)phenyl]-4,6-dihydropyrrolo[3,4-d]pyrazol-3-amine.
| Compound Name | 1-methyl-5-[2-nitro-4-(trifluoromethyl)phenyl]-4,6-dihydropyrrolo[3,4-d]pyrazol-3-amine |
|---|---|
| PubChem CID | 125420689 |
| Molecular Formula | C13H12F3N5O2 |
| Molecular Weight | 327.27 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 1-methyl-5-[2-nitro-4-(trifluoromethyl)phenyl]-4,6-dihydropyrrolo[3,4-d]pyrazol-3-amine |
| SMILES | Cn1nc(N)c2c1CN(c1ccc(C(F)(F)F)cc1[N+](=O)[O-])C2 |
| InChI | InChI=1S/C13H12F3N5O2/c1-19-11-6-20(5-8(11)12(17)18-19)9-3-2-7(13(14,15)16)4-10(9)21(22)23/h2-4H,5-6H2,1H3,(H2,17,18) |
| InChIKey | NRHBOTCYVPIGJE-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 90.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.27 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|