C18H23NO4 — CID 125421217
ethyl 2-[[(1S)-cyclohex-3-ene-1-carbonyl]-[(2-hydroxyphenyl)methyl]amino]acetate (PubChem CID 125421217) has the molecular formula C18H23NO4 and a molecular weight of 317.39 g/mol. Its IUPAC name is ethyl 2-[[(1S)-cyclohex-3-ene-1-carbonyl]-[(2-hydroxyphenyl)methyl]amino]acetate.
| Compound Name | ethyl 2-[[(1S)-cyclohex-3-ene-1-carbonyl]-[(2-hydroxyphenyl)methyl]amino]acetate |
|---|---|
| PubChem CID | 125421217 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | ethyl 2-[[(1S)-cyclohex-3-ene-1-carbonyl]-[(2-hydroxyphenyl)methyl]amino]acetate |
| SMILES | CCOC(=O)CN(Cc1ccccc1O)C(=O)[C@@H]1CC=CCC1 |
| InChI | InChI=1S/C18H23NO4/c1-2-23-17(21)13-19(12-15-10-6-7-11-16(15)20)18(22)14-8-4-3-5-9-14/h3-4,6-7,10-11,14,20H,2,5,8-9,12-13H2,1H3/t14-/m1/s1 |
| InChIKey | KCIBCBRMPRIANW-CQSZACIVSA-N |
| XLogP | 2.64 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|