C19H25NO5 — CID 94823719
methyl 2-[[(1S)-cyclohex-3-ene-1-carbonyl]-[(3,5-dimethoxyphenyl)methyl]amino]acetate (PubChem CID 94823719) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is methyl 2-[[(1S)-cyclohex-3-ene-1-carbonyl]-[(3,5-dimethoxyphenyl)methyl]amino]acetate.
| Compound Name | methyl 2-[[(1S)-cyclohex-3-ene-1-carbonyl]-[(3,5-dimethoxyphenyl)methyl]amino]acetate |
|---|---|
| PubChem CID | 94823719 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | methyl 2-[[(1S)-cyclohex-3-ene-1-carbonyl]-[(3,5-dimethoxyphenyl)methyl]amino]acetate |
| SMILES | COC(=O)CN(Cc1cc(OC)cc(OC)c1)C(=O)[C@@H]1CC=CCC1 |
| InChI | InChI=1S/C19H25NO5/c1-23-16-9-14(10-17(11-16)24-2)12-20(13-18(21)25-3)19(22)15-7-5-4-6-8-15/h4-5,9-11,15H,6-8,12-13H2,1-3H3/t15-/m1/s1 |
| InChIKey | VPWMRSBZGHVFNR-OAHLLOKOSA-N |
| XLogP | 2.56 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|