C18H25NO4 — CID 95622434
(1S)-N-[(2,4-dimethoxyphenyl)methyl]-N-(2-hydroxyethyl)cyclohex-3-ene-1-carboxamide (PubChem CID 95622434) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is (1S)-N-[(2,4-dimethoxyphenyl)methyl]-N-(2-hydroxyethyl)cyclohex-3-ene-1-carboxamide.
| Compound Name | (1S)-N-[(2,4-dimethoxyphenyl)methyl]-N-(2-hydroxyethyl)cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 95622434 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | (1S)-N-[(2,4-dimethoxyphenyl)methyl]-N-(2-hydroxyethyl)cyclohex-3-ene-1-carboxamide |
| SMILES | COc1ccc(CN(CCO)C(=O)[C@@H]2CC=CCC2)c(OC)c1 |
| InChI | InChI=1S/C18H25NO4/c1-22-16-9-8-15(17(12-16)23-2)13-19(10-11-20)18(21)14-6-4-3-5-7-14/h3-4,8-9,12,14,20H,5-7,10-11,13H2,1-2H3/t14-/m1/s1 |
| InChIKey | YBBBDLPBRPYZGU-CQSZACIVSA-N |
| XLogP | 2.38 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|