C18H24N4O3S — CID 125422114
1-[(3R)-1-benzoylpiperidin-3-yl]-N-[(1-methylpyrazol-4-yl)methyl]methanesulfonamide (PubChem CID 125422114) has the molecular formula C18H24N4O3S and a molecular weight of 376.48 g/mol. Its IUPAC name is 1-[(3R)-1-benzoylpiperidin-3-yl]-N-[(1-methylpyrazol-4-yl)methyl]methanesulfonamide.
| Compound Name | 1-[(3R)-1-benzoylpiperidin-3-yl]-N-[(1-methylpyrazol-4-yl)methyl]methanesulfonamide |
|---|---|
| PubChem CID | 125422114 |
| Molecular Formula | C18H24N4O3S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 1-[(3R)-1-benzoylpiperidin-3-yl]-N-[(1-methylpyrazol-4-yl)methyl]methanesulfonamide |
| SMILES | Cn1cc(CNS(=O)(=O)C[C@@H]2CCCN(C(=O)c3ccccc3)C2)cn1 |
| InChI | InChI=1S/C18H24N4O3S/c1-21-12-16(10-19-21)11-20-26(24,25)14-15-6-5-9-22(13-15)18(23)17-7-3-2-4-8-17/h2-4,7-8,10,12,15,20H,5-6,9,11,13-14H2,1H3/t15-/m1/s1 |
| InChIKey | SVUWOSWNMPBHSR-OAHLLOKOSA-N |
| XLogP | 1.39 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |