C15H24N4O4S — CID 129009244
(1-methylpyrazol-4-yl)-[3-(morpholin-4-ylsulfonylmethyl)piperidin-1-yl]methanone (PubChem CID 129009244) has the molecular formula C15H24N4O4S and a molecular weight of 356.45 g/mol. Its IUPAC name is (1-methylpyrazol-4-yl)-[3-(morpholin-4-ylsulfonylmethyl)piperidin-1-yl]methanone.
| Compound Name | (1-methylpyrazol-4-yl)-[3-(morpholin-4-ylsulfonylmethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 129009244 |
| Molecular Formula | C15H24N4O4S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | (1-methylpyrazol-4-yl)-[3-(morpholin-4-ylsulfonylmethyl)piperidin-1-yl]methanone |
| SMILES | Cn1cc(C(=O)N2CCCC(CS(=O)(=O)N3CCOCC3)C2)cn1 |
| InChI | InChI=1S/C15H24N4O4S/c1-17-11-14(9-16-17)15(20)18-4-2-3-13(10-18)12-24(21,22)19-5-7-23-8-6-19/h9,11,13H,2-8,10,12H2,1H3 |
| InChIKey | SWIOKKFKUIBHQG-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 84.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |